C27H25F3O9 — CID 164614778
methyl 2-[4-[(1E,6E)-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-3,5-dioxohepta-1,6-dienyl]-2-(trifluoromethyl)phenoxy]acetate (PubChem CID 164614778) has the molecular formula C27H25F3O9 and a molecular weight of 550.48 g/mol. Its IUPAC name is methyl 2-[4-[(1E,6E)-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-3,5-dioxohepta-1,6-dienyl]-2-(trifluoromethyl)phenoxy]acetate.
| Compound Name | methyl 2-[4-[(1E,6E)-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-3,5-dioxohepta-1,6-dienyl]-2-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 164614778 |
| Molecular Formula | C27H25F3O9 |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | methyl 2-[4-[(1E,6E)-7-[3-methoxy-4-(2-methoxy-2-oxoethoxy)phenyl]-3,5-dioxohepta-1,6-dienyl]-2-(trifluoromethyl)phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCC(=O)OC)c(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C27H25F3O9/c1-35-24-13-18(7-11-23(24)39-16-26(34)37-3)5-9-20(32)14-19(31)8-4-17-6-10-22(38-15-25(33)36-2)21(12-17)27(28,29)30/h4-13H,14-16H2,1-3H3/b8-4+,9-5+ |
| InChIKey | ZLUJTEVTQVTZFW-KBXRYBNXSA-N |
| XLogP | 4.07 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|