C27H29N7O3 — CID 164614786
N-[3-[[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 164614786) has the molecular formula C27H29N7O3 and a molecular weight of 499.58 g/mol. Its IUPAC name is N-[3-[[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 164614786 |
| Molecular Formula | C27H29N7O3 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | N-[3-[[2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c(OC)c3)nc3[nH]ccc23)c1 |
| InChI | InChI=1S/C27H29N7O3/c1-4-24(35)29-18-6-5-7-20(16-18)37-26-21-10-11-28-25(21)31-27(32-26)30-19-8-9-22(23(17-19)36-3)34-14-12-33(2)13-15-34/h4-11,16-17H,1,12-15H2,2-3H3,(H,29,35)(H2,28,30,31,32) |
| InChIKey | AZKCFFWQXXUDOF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|