C21H22N4O3S2 — CID 164614851
2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethanesulfonamide (PubChem CID 164614851) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethanesulfonamide.
| Compound Name | 2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 164614851 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-[[2-(4-phenyl-2,3-dihydroindole-1-carbonyl)-1,3-thiazol-5-yl]methylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCc1cnc(C(=O)N2CCc3c(-c4ccccc4)cccc32)s1 |
| InChI | InChI=1S/C21H22N4O3S2/c22-30(27,28)12-10-23-13-16-14-24-20(29-16)21(26)25-11-9-18-17(7-4-8-19(18)25)15-5-2-1-3-6-15/h1-8,14,23H,9-13H2,(H2,22,27,28) |
| InChIKey | BSYMBPKGGSCPNT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|