C18H23NO4S — CID 164614893
1-[[5-ethyl-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol (PubChem CID 164614893) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 1-[[5-ethyl-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol.
| Compound Name | 1-[[5-ethyl-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 164614893 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-[[5-ethyl-3-(4-methylsulfonylphenyl)-2-pyridinyl]oxy]-2-methylpropan-2-ol |
| SMILES | CCc1cnc(OCC(C)(C)O)c(-c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H23NO4S/c1-5-13-10-16(17(19-11-13)23-12-18(2,3)20)14-6-8-15(9-7-14)24(4,21)22/h6-11,20H,5,12H2,1-4H3 |
| InChIKey | BJBKMIXLHYBCCH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |