About N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine
N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine (PubChem CID 164614957) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine.
Molecular Properties
| Compound Name | N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine |
| PubChem CID | 164614957 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine |
| SMILES | CCCCN(c1ccnc(C)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-6-7-10-21(15-8-9-20-14(2)11-15)16-12-17(22-3)19(24-5)18(13-16)23-4/h8-9,11-13H,6-7,10H2,1-5H3 |
| InChIKey | UWSRUFRRGMGFOR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine?
The IUPAC name of N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine (CID 164614957) is N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine.
What is the SMILES notation for N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine?
The canonical SMILES for N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine is CCCCN(c1ccnc(C)c1)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine?
The InChIKey is UWSRUFRRGMGFOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-6-7-10-21(15-8-9-20-14(2)11-15)16-12-17(22-3)19(24-5)18(13-16)23-4/h8-9,11-13H,6-7,10H2,1-5H3.
What are the key properties of N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine?
N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine has a molecular weight of 330.43 g/mol, XLogP of 4.35, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-methyl-N-(3,4,5-trimethoxyphenyl)pyridin-4-amine is sourced from PubChem (CID 164614957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).