C23H34N2O4S — CID 164615066
methyl 4-[(5S,6R,9R,13S)-7-(4-methylphenyl)sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 164615066) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is methyl 4-[(5S,6R,9R,13S)-7-(4-methylphenyl)sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | methyl 4-[(5S,6R,9R,13S)-7-(4-methylphenyl)sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 164615066 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl 4-[(5S,6R,9R,13S)-7-(4-methylphenyl)sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1S(=O)(=O)c1ccc(C)cc1)[C@@H]23 |
| InChI | InChI=1S/C23H34N2O4S/c1-17-10-12-19(13-11-17)30(27,28)25-16-18-6-4-14-24-15-5-7-20(23(18)24)21(25)8-3-9-22(26)29-2/h10-13,18,20-21,23H,3-9,14-16H2,1-2H3/t18-,20-,21-,23+/m1/s1 |
| InChIKey | ZNIHJSYQCRYKNQ-LPOZWGFCSA-N |
| XLogP | 3.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |