C13H13Cl3N2 — CID 164615123
5,7-dichloro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride (PubChem CID 164615123) has the molecular formula C13H13Cl3N2 and a molecular weight of 303.62 g/mol. Its IUPAC name is 5,7-dichloro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride.
| Compound Name | 5,7-dichloro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
|---|---|
| PubChem CID | 164615123 |
| Molecular Formula | C13H13Cl3N2 |
| Molecular Weight | 303.62 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5,7-dichloro-1,2,3,4-tetrahydroacridin-9-amine;hydrochloride |
| SMILES | Cl.Nc1c2c(nc3c(Cl)cc(Cl)cc13)CCCC2 |
| InChI | InChI=1S/C13H12Cl2N2.ClH/c14-7-5-9-12(16)8-3-1-2-4-11(8)17-13(9)10(15)6-7;/h5-6H,1-4H2,(H2,16,17);1H |
| InChIKey | LGCMTNAYQLXBAX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |