C31H31N5O3 — CID 164615324
ethyl 2-[4-[3-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-ynylidene]piperidin-1-yl]acetate (PubChem CID 164615324) has the molecular formula C31H31N5O3 and a molecular weight of 521.62 g/mol. Its IUPAC name is ethyl 2-[4-[3-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-ynylidene]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[3-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-ynylidene]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 164615324 |
| Molecular Formula | C31H31N5O3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | ethyl 2-[4-[3-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylphenyl]prop-2-ynylidene]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(=CC#Cc2cc(C)c(Oc3ccnc(Nc4ccc(C#N)cc4)n3)c(C)c2)CC1 |
| InChI | InChI=1S/C31H31N5O3/c1-4-38-29(37)21-36-16-13-24(14-17-36)6-5-7-26-18-22(2)30(23(3)19-26)39-28-12-15-33-31(35-28)34-27-10-8-25(20-32)9-11-27/h6,8-12,15,18-19H,4,13-14,16-17,21H2,1-3H3,(H,33,34,35) |
| InChIKey | ZMEMUQWEFGABJT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|