C19H17N5O2S — CID 164615328
5-benzyl-N-[(3S)-4-sulfanylidene-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 164615328) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 5-benzyl-N-[(3S)-4-sulfanylidene-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3S)-4-sulfanylidene-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 164615328 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 5-benzyl-N-[(3S)-4-sulfanylidene-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(N[C@H]1COc2ccccc2NC1=S)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H17N5O2S/c25-18(17-22-16(23-24-17)10-12-6-2-1-3-7-12)20-14-11-26-15-9-5-4-8-13(15)21-19(14)27/h1-9,14H,10-11H2,(H,20,25)(H,21,27)(H,22,23,24)/t14-/m0/s1 |
| InChIKey | VTHFRWFGIPFICT-AWEZNQCLSA-N |
| XLogP | 2.33 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|