C25H22FNO3S — CID 164615358
[4-(4-fluorophenyl)sulfanylphenyl]-[1-(3-hydroxybenzoyl)piperidin-4-yl]methanone (PubChem CID 164615358) has the molecular formula C25H22FNO3S and a molecular weight of 435.52 g/mol. Its IUPAC name is [4-(4-fluorophenyl)sulfanylphenyl]-[1-(3-hydroxybenzoyl)piperidin-4-yl]methanone.
| Compound Name | [4-(4-fluorophenyl)sulfanylphenyl]-[1-(3-hydroxybenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 164615358 |
| Molecular Formula | C25H22FNO3S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | [4-(4-fluorophenyl)sulfanylphenyl]-[1-(3-hydroxybenzoyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(Sc2ccc(F)cc2)cc1)C1CCN(C(=O)c2cccc(O)c2)CC1 |
| InChI | InChI=1S/C25H22FNO3S/c26-20-6-10-23(11-7-20)31-22-8-4-17(5-9-22)24(29)18-12-14-27(15-13-18)25(30)19-2-1-3-21(28)16-19/h1-11,16,18,28H,12-15H2 |
| InChIKey | RGNNPMOXBDNQEI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |