C22H19N5O2 — CID 164615547
4-[(2,5-diphenyl-1,2,4-triazol-3-yl)methylamino]-N-hydroxybenzamide (PubChem CID 164615547) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-[(2,5-diphenyl-1,2,4-triazol-3-yl)methylamino]-N-hydroxybenzamide.
| Compound Name | 4-[(2,5-diphenyl-1,2,4-triazol-3-yl)methylamino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164615547 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-[(2,5-diphenyl-1,2,4-triazol-3-yl)methylamino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(NCc2nc(-c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N5O2/c28-22(26-29)17-11-13-18(14-12-17)23-15-20-24-21(16-7-3-1-4-8-16)25-27(20)19-9-5-2-6-10-19/h1-14,23,29H,15H2,(H,26,28) |
| InChIKey | LSTMHRZEOHLEAB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|