C20H24O4 — CID 164615574
(2R,5aR,9aS)-6,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,3,5,5a,8,9-hexahydro-1H-cyclopenta[a]naphthalene-4,7-dione (PubChem CID 164615574) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2R,5aR,9aS)-6,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,3,5,5a,8,9-hexahydro-1H-cyclopenta[a]naphthalene-4,7-dione.
| Compound Name | (2R,5aR,9aS)-6,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,3,5,5a,8,9-hexahydro-1H-cyclopenta[a]naphthalene-4,7-dione |
|---|---|
| PubChem CID | 164615574 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2R,5aR,9aS)-6,6,9a-trimethyl-2-(5-oxo-2H-furan-4-yl)-2,3,5,5a,8,9-hexahydro-1H-cyclopenta[a]naphthalene-4,7-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)C3=C(C[C@H](C4=CCOC4=O)C3)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C20H24O4/c1-19(2)16-10-15(21)13-8-11(12-5-7-24-18(12)23)9-14(13)20(16,3)6-4-17(19)22/h5,11,16H,4,6-10H2,1-3H3/t11-,16-,20+/m0/s1 |
| InChIKey | FPGSYRLSLNWAPP-XITNVPRNSA-N |
| XLogP | 3.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |