C21H18O2 — CID 164615588
(2S,3S)-3-methoxy-2,3-diphenyl-2H-1-benzofuran (PubChem CID 164615588) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S,3S)-3-methoxy-2,3-diphenyl-2H-1-benzofuran.
| Compound Name | (2S,3S)-3-methoxy-2,3-diphenyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 164615588 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2S,3S)-3-methoxy-2,3-diphenyl-2H-1-benzofuran |
| SMILES | CO[C@@]1(c2ccccc2)c2ccccc2O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H18O2/c1-22-21(17-12-6-3-7-13-17)18-14-8-9-15-19(18)23-20(21)16-10-4-2-5-11-16/h2-15,20H,1H3/t20-,21-/m0/s1 |
| InChIKey | DNPPJGUDHWHBDH-SFTDATJTSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |