C20H30O3 — CID 164615659
(1S,4R,6R,9Z,12R)-9-(hydroxymethyl)-4,12-dimethyl-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-14-one (PubChem CID 164615659) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,4R,6R,9Z,12R)-9-(hydroxymethyl)-4,12-dimethyl-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-14-one.
| Compound Name | (1S,4R,6R,9Z,12R)-9-(hydroxymethyl)-4,12-dimethyl-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-14-one |
|---|---|
| PubChem CID | 164615659 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,4R,6R,9Z,12R)-9-(hydroxymethyl)-4,12-dimethyl-15-propan-2-ylidene-5-oxatricyclo[10.3.0.04,6]pentadec-9-en-14-one |
| SMILES | CC(C)=C1C(=O)C[C@@]2(C)C/C=C(\CO)CC[C@H]3O[C@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C20H30O3/c1-13(2)18-15-8-10-20(4)17(23-20)6-5-14(12-21)7-9-19(15,3)11-16(18)22/h7,15,17,21H,5-6,8-12H2,1-4H3/b14-7-/t15-,17-,19-,20-/m1/s1 |
| InChIKey | XHCQIKYHHAOUHL-NVTAXPAGSA-N |
| XLogP | 3.96 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|