C19H27N3O2 — CID 164615666
6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]methyl]-N-hydroxypyridine-3-carboxamide (PubChem CID 164615666) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]methyl]-N-hydroxypyridine-3-carboxamide.
| Compound Name | 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]methyl]-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 164615666 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]methyl]-N-hydroxypyridine-3-carboxamide |
| SMILES | C[C@]12CC3CC(NCc4ccc(C(=O)NO)cn4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C19H27N3O2/c1-17-5-13-6-18(2,10-17)12-19(7-13,11-17)21-9-15-4-3-14(8-20-15)16(23)22-24/h3-4,8,13,21,24H,5-7,9-12H2,1-2H3,(H,22,23)/t13?,17-,18+,19? |
| InChIKey | MZOJQVXYXQOZQF-DFDFAMMDSA-N |
| XLogP | 3.04 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|