C36H43FN2O5 — CID 164615716
[2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 164615716) has the molecular formula C36H43FN2O5 and a molecular weight of 602.75 g/mol. Its IUPAC name is [2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | [2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 164615716 |
| Molecular Formula | C36H43FN2O5 |
| Molecular Weight | 602.75 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | [2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethyl] (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)OCC(=O)Nc4ccc(F)cn4)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C36H43FN2O5/c1-21-23-8-9-26-34(4,24(23)17-25(40)30(21)42)14-16-36(6)27-18-33(3,12-11-32(27,2)13-15-35(26,36)5)31(43)44-20-29(41)39-28-10-7-22(37)19-38-28/h7-10,17,19,27,42H,11-16,18,20H2,1-6H3,(H,38,39,41)/t27-,32-,33-,34+,35-,36+/m1/s1 |
| InChIKey | MUENUQLHXOINNW-JIYWGDHNSA-N |
| XLogP | 7.33 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.75 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |