About 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one
8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one (PubChem CID 164615740) has the molecular formula C26H25N3O3
and a molecular weight of 427.50 g/mol. Its IUPAC name is 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one |
| PubChem CID | 164615740 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one |
| SMILES | COc1cccc(CN2CC(C)(C)Oc3cc(-c4ccc5[nH]ncc5c4)ccc3C2=O)c1 |
| InChI | InChI=1S/C26H25N3O3/c1-26(2)16-29(15-17-5-4-6-21(11-17)31-3)25(30)22-9-7-19(13-24(22)32-26)18-8-10-23-20(12-18)14-27-28-23/h4-14H,15-16H2,1-3H3,(H,27,28) |
| InChIKey | IIVFQRPDFQWYIO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one?
The IUPAC name of 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one (CID 164615740) is 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one.
What is the SMILES notation for 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one?
The canonical SMILES for 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one is COc1cccc(CN2CC(C)(C)Oc3cc(-c4ccc5[nH]ncc5c4)ccc3C2=O)c1.
What is the InChIKey of 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one?
The InChIKey is IIVFQRPDFQWYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O3/c1-26(2)16-29(15-17-5-4-6-21(11-17)31-3)25(30)22-9-7-19(13-24(22)32-26)18-8-10-23-20(12-18)14-27-28-23/h4-14H,15-16H2,1-3H3,(H,27,28).
What are the key properties of 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one?
8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one has a molecular weight of 427.50 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1H-indazol-5-yl)-4-[(3-methoxyphenyl)methyl]-2,2-dimethyl-3H-1,4-benzoxazepin-5-one is sourced from PubChem (CID 164615740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).