C47H47IN4S — CID 164615750
4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]-N,N-diphenylaniline iodide (PubChem CID 164615750) has the molecular formula C47H47IN4S and a molecular weight of 826.89 g/mol. Its IUPAC name is 4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]-N,N-diphenylaniline iodide.
| Compound Name | 4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]-N,N-diphenylaniline iodide |
|---|---|
| PubChem CID | 164615750 |
| Molecular Formula | C47H47IN4S |
| Molecular Weight | 826.89 g/mol |
| Exact Mass | 826.26 |
| IUPAC Name | 4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]-N,N-diphenylaniline iodide |
| SMILES | CC1CCN(CCCN2/C(=C/c3cc(/C=C/c4ccc(N(c5ccccc5)c5ccccc5)cc4)[n+](C)c4ccccc34)Sc3ccccc32)CC1.[I-] |
| InChI | InChI=1S/C47H47N4S.HI/c1-36-28-32-49(33-29-36)30-13-31-50-45-20-11-12-21-46(45)52-47(50)35-38-34-42(48(2)44-19-10-9-18-43(38)44)27-24-37-22-25-41(26-23-37)51(39-14-5-3-6-15-39)40-16-7-4-8-17-40;/h3-12,14-27,34-36H,13,28-33H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QJXFPYUKLNMZLM-UHFFFAOYSA-M |
| XLogP | 8.34 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.89 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|