C19H16INO2 — CID 164615796
3-benzyl-11-(iodomethyl)-10-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 164615796) has the molecular formula C19H16INO2 and a molecular weight of 417.25 g/mol. Its IUPAC name is 3-benzyl-11-(iodomethyl)-10-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 3-benzyl-11-(iodomethyl)-10-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 164615796 |
| Molecular Formula | C19H16INO2 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 3-benzyl-11-(iodomethyl)-10-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | O=C1OC(CI)Cc2cn(Cc3ccccc3)c3cccc1c23 |
| InChI | InChI=1S/C19H16INO2/c20-10-15-9-14-12-21(11-13-5-2-1-3-6-13)17-8-4-7-16(18(14)17)19(22)23-15/h1-8,12,15H,9-11H2 |
| InChIKey | GCZAXYVJFUTYNB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|