About 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide
4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide (PubChem CID 164615931) has the molecular formula C17H18N2O2S
and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide |
| PubChem CID | 164615931 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2CCCSc3ccccc32)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c20-17(18-21)14-8-6-13(7-9-14)12-19-10-3-11-22-16-5-2-1-4-15(16)19/h1-2,4-9,21H,3,10-12H2,(H,18,20) |
| InChIKey | CHULCWZHWRQEQG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide?
The IUPAC name of 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide (CID 164615931) is 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide.
What is the SMILES notation for 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide?
The canonical SMILES for 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide is O=C(NO)c1ccc(CN2CCCSc3ccccc32)cc1.
What is the InChIKey of 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide?
The InChIKey is CHULCWZHWRQEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2S/c20-17(18-21)14-8-6-13(7-9-14)12-19-10-3-11-22-16-5-2-1-4-15(16)19/h1-2,4-9,21H,3,10-12H2,(H,18,20).
What are the key properties of 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide?
4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide has a molecular weight of 314.41 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-1,5-benzothiazepin-5-ylmethyl)-N-hydroxybenzamide is sourced from PubChem (CID 164615931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).