About benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride
benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride (PubChem CID 164616075) has the molecular formula C30H32ClN3O4S
and a molecular weight of 566.12 g/mol. Its IUPAC name is benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride |
| PubChem CID | 164616075 |
| Molecular Formula | C30H32ClN3O4S |
| Molecular Weight | 566.12 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)N1CCC(Nc2cccc3c(S(=O)(=O)NCc4ccccc4)cccc23)CC1 |
| InChI | InChI=1S/C30H31N3O4S.ClH/c34-30(37-22-24-11-5-2-6-12-24)33-19-17-25(18-20-33)32-28-15-7-14-27-26(28)13-8-16-29(27)38(35,36)31-21-23-9-3-1-4-10-23;/h1-16,25,31-32H,17-22H2;1H |
| InChIKey | OFUOYSGDRQQVST-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.12 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride?
The IUPAC name of benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride (CID 164616075) is benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride.
What is the SMILES notation for benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride?
The canonical SMILES for benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride is Cl.O=C(OCc1ccccc1)N1CCC(Nc2cccc3c(S(=O)(=O)NCc4ccccc4)cccc23)CC1.
What is the InChIKey of benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride?
The InChIKey is OFUOYSGDRQQVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31N3O4S.ClH/c34-30(37-22-24-11-5-2-6-12-24)33-19-17-25(18-20-33)32-28-15-7-14-27-26(28)13-8-16-29(27)38(35,36)31-21-23-9-3-1-4-10-23;/h1-16,25,31-32H,17-22H2;1H.
What are the key properties of benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride?
benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride has a molecular weight of 566.12 g/mol, XLogP of 5.95, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[[5-(benzylsulfamoyl)naphthalen-1-yl]amino]piperidine-1-carboxylate;hydrochloride is sourced from PubChem (CID 164616075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).