C17H21N5O3 — CID 164616192
N-tert-butyl-4-(4-oxidopyrazin-4-ium-2-yl)-11-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-5-carboxamide (PubChem CID 164616192) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-tert-butyl-4-(4-oxidopyrazin-4-ium-2-yl)-11-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-5-carboxamide.
| Compound Name | N-tert-butyl-4-(4-oxidopyrazin-4-ium-2-yl)-11-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-5-carboxamide |
|---|---|
| PubChem CID | 164616192 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-tert-butyl-4-(4-oxidopyrazin-4-ium-2-yl)-11-oxa-3,4-diazatricyclo[6.2.1.02,6]undeca-2,5-diene-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1c2c(nn1-c1c[n+]([O-])ccn1)C1CCC(C2)O1 |
| InChI | InChI=1S/C17H21N5O3/c1-17(2,3)19-16(23)15-11-8-10-4-5-12(25-10)14(11)20-22(15)13-9-21(24)7-6-18-13/h6-7,9-10,12H,4-5,8H2,1-3H3,(H,19,23) |
| InChIKey | GRPNWAWPKOWQPW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|