C41H41NO8 — CID 164616301
(5R,5aR,8aR,9S)-9-[5-[(4-tert-butylphenyl)methoxy]-1H-indol-3-yl]-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one (PubChem CID 164616301) has the molecular formula C41H41NO8 and a molecular weight of 675.78 g/mol. Its IUPAC name is (5R,5aR,8aR,9S)-9-[5-[(4-tert-butylphenyl)methoxy]-1H-indol-3-yl]-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one.
| Compound Name | (5R,5aR,8aR,9S)-9-[5-[(4-tert-butylphenyl)methoxy]-1H-indol-3-yl]-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one |
|---|---|
| PubChem CID | 164616301 |
| Molecular Formula | C41H41NO8 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.28 |
| IUPAC Name | (5R,5aR,8aR,9S)-9-[5-[(4-tert-butylphenyl)methoxy]-1H-indol-3-yl]-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-6-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](c3c[nH]c5ccc(OCc6ccc(C(C)(C)C)cc6)cc35)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C41H41NO8/c1-41(2,3)24-9-7-22(8-10-24)19-47-25-11-12-31-26(15-25)29(18-42-31)37-28-17-33-32(49-21-50-33)16-27(28)36(38-30(37)20-48-40(38)43)23-13-34(44-4)39(46-6)35(14-23)45-5/h7-18,30,36-38,42H,19-21H2,1-6H3/t30-,36-,37+,38+/m1/s1 |
| InChIKey | QFFIPTSLHYHTKY-AEQTWNFXSA-N |
| XLogP | 7.87 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |