About N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide
N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide (PubChem CID 164616377) has the molecular formula C17H11ClN4O2S2
and a molecular weight of 402.89 g/mol. Its IUPAC name is N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide |
| PubChem CID | 164616377 |
| Molecular Formula | C17H11ClN4O2S2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2cnc3scnc3c2)cnc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H11ClN4O2S2/c18-16-14(22-26(23,24)13-4-2-1-3-5-13)6-11(8-19-16)12-7-15-17(20-9-12)25-10-21-15/h1-10,22H |
| InChIKey | KKJLCITVXGVBEU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide?
The IUPAC name of N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide (CID 164616377) is N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide.
What is the SMILES notation for N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide?
The canonical SMILES for N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide is O=S(=O)(Nc1cc(-c2cnc3scnc3c2)cnc1Cl)c1ccccc1.
What is the InChIKey of N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide?
The InChIKey is KKJLCITVXGVBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN4O2S2/c18-16-14(22-26(23,24)13-4-2-1-3-5-13)6-11(8-19-16)12-7-15-17(20-9-12)25-10-21-15/h1-10,22H.
What are the key properties of N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide?
N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide has a molecular weight of 402.89 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-chloro-5-([1,3]thiazolo[5,4-b]pyridin-6-yl)-3-pyridinyl]benzenesulfonamide is sourced from PubChem (CID 164616377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).