About 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride
2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride (PubChem CID 164616393) has the molecular formula C22H17ClN2S
and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride.
Molecular Properties
| Compound Name | 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride |
| PubChem CID | 164616393 |
| Molecular Formula | C22H17ClN2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride |
| SMILES | Cc1cccc2c[n+](C)c3ccc(-c4nc5ccccc5s4)cc3c12.[Cl-] |
| InChI | InChI=1S/C22H17N2S.ClH/c1-14-6-5-7-16-13-24(2)19-11-10-15(12-17(19)21(14)16)22-23-18-8-3-4-9-20(18)25-22;/h3-13H,1-2H3;1H/q+1;/p-1 |
| InChIKey | AGFCDBWDKLMUGW-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride?
The IUPAC name of 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride (CID 164616393) is 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride.
What is the SMILES notation for 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride?
The canonical SMILES for 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride is Cc1cccc2c[n+](C)c3ccc(-c4nc5ccccc5s4)cc3c12.[Cl-].
What is the InChIKey of 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride?
The InChIKey is AGFCDBWDKLMUGW-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H17N2S.ClH/c1-14-6-5-7-16-13-24(2)19-11-10-15(12-17(19)21(14)16)22-23-18-8-3-4-9-20(18)25-22;/h3-13H,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride?
2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride has a molecular weight of 376.91 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,10-dimethylphenanthridin-5-ium-2-yl)-1,3-benzothiazole chloride is sourced from PubChem (CID 164616393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).