About 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine
1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine (PubChem CID 164616454) has the molecular formula C23H30N2O
and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine.
Molecular Properties
| Compound Name | 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine |
| PubChem CID | 164616454 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine |
| SMILES | c1ccc([C@@H]2CCC[C@H](CCN3CCN(c4ccccc4)CC3)O2)cc1 |
| InChI | InChI=1S/C23H30N2O/c1-3-8-20(9-4-1)23-13-7-12-22(26-23)14-15-24-16-18-25(19-17-24)21-10-5-2-6-11-21/h1-6,8-11,22-23H,7,12-19H2/t22-,23+/m1/s1 |
| InChIKey | BEZXRTIXFCIASE-PKTZIBPZSA-N |
| XLogP | 4.51 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine?
The IUPAC name of 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine (CID 164616454) is 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine.
What is the SMILES notation for 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine?
The canonical SMILES for 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine is c1ccc([C@@H]2CCC[C@H](CCN3CCN(c4ccccc4)CC3)O2)cc1.
What is the InChIKey of 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine?
The InChIKey is BEZXRTIXFCIASE-PKTZIBPZSA-N. The full InChI is InChI=1S/C23H30N2O/c1-3-8-20(9-4-1)23-13-7-12-22(26-23)14-15-24-16-18-25(19-17-24)21-10-5-2-6-11-21/h1-6,8-11,22-23H,7,12-19H2/t22-,23+/m1/s1.
What are the key properties of 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine?
1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine has a molecular weight of 350.51 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]piperazine is sourced from PubChem (CID 164616454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).