C23H27ClN2O4 — CID 164616486
N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide (PubChem CID 164616486) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide.
| Compound Name | N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 164616486 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-4-chlorobenzamide |
| SMILES | COc1ccc2c(c1)[C@H]1OCCN(CCCCNC(=O)c3ccc(Cl)cc3)[C@@H]1CO2 |
| InChI | InChI=1S/C23H27ClN2O4/c1-28-18-8-9-21-19(14-18)22-20(15-30-21)26(12-13-29-22)11-3-2-10-25-23(27)16-4-6-17(24)7-5-16/h4-9,14,20,22H,2-3,10-13,15H2,1H3,(H,25,27)/t20-,22-/m1/s1 |
| InChIKey | QWSLRVUGOHVJKP-IFMALSPDSA-N |
| XLogP | 3.69 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|