About 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid
4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid (PubChem CID 164616546) has the molecular formula C25H24N2O4S
and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid |
| PubChem CID | 164616546 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid |
| SMILES | COc1ccc(CCN(Cc2ccc(C(=O)O)cc2)c2nc3ccc(CO)cc3s2)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-31-21-9-4-17(5-10-21)12-13-27(15-18-2-7-20(8-3-18)24(29)30)25-26-22-11-6-19(16-28)14-23(22)32-25/h2-11,14,28H,12-13,15-16H2,1H3,(H,29,30) |
| InChIKey | GEIXFTWPZPWBLX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid?
The IUPAC name of 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid (CID 164616546) is 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid.
What is the SMILES notation for 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid?
The canonical SMILES for 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid is COc1ccc(CCN(Cc2ccc(C(=O)O)cc2)c2nc3ccc(CO)cc3s2)cc1.
What is the InChIKey of 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid?
The InChIKey is GEIXFTWPZPWBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O4S/c1-31-21-9-4-17(5-10-21)12-13-27(15-18-2-7-20(8-3-18)24(29)30)25-26-22-11-6-19(16-28)14-23(22)32-25/h2-11,14,28H,12-13,15-16H2,1H3,(H,29,30).
What are the key properties of 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid?
4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid has a molecular weight of 448.54 g/mol, XLogP of 4.74, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[6-(hydroxymethyl)-1,3-benzothiazol-2-yl]-[2-(4-methoxyphenyl)ethyl]amino]methyl]benzoic acid is sourced from PubChem (CID 164616546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).