C33H36N4O4 — CID 164616655
3-[(2S,3S)-8-ethenyl-13-ethyl-18-methoxycarbonyl-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 164616655) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-[(2S,3S)-8-ethenyl-13-ethyl-18-methoxycarbonyl-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-18-methoxycarbonyl-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 164616655 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-18-methoxycarbonyl-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3nc(cc4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)OC)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C33H36N4O4/c1-8-20-16(3)23-12-24-18(5)22(10-11-31(38)39)29(36-24)15-30-32(33(40)41-7)19(6)26(37-30)14-28-21(9-2)17(4)25(35-28)13-27(20)34-23/h8,12-15,18,22,34-35H,1,9-11H2,2-7H3,(H,38,39)/b23-12-,24-12-,25-13-,26-14-,27-13-,28-14-,29-15-,30-15-/t18-,22-/m0/s1 |
| InChIKey | BZFKWNHCVXSIFB-YNXQTFLYSA-N |
| XLogP | 6.99 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |