C24H26FIN6O5 — CID 164616759
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]pentanoic acid (PubChem CID 164616759) has the molecular formula C24H26FIN6O5 and a molecular weight of 624.41 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 164616759 |
| Molecular Formula | C24H26FIN6O5 |
| Molecular Weight | 624.41 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-hydroxy-3-iodophenyl)propanoyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@H](Cc1ccc(O)c(I)c1)NC(=O)c1cc2c(F)cccc2[nH]1)C(=O)O |
| InChI | InChI=1S/C24H26FIN6O5/c25-14-3-1-4-16-13(14)11-19(30-16)22(35)32-18(10-12-6-7-20(33)15(26)9-12)21(34)31-17(23(36)37)5-2-8-29-24(27)28/h1,3-4,6-7,9,11,17-18,30,33H,2,5,8,10H2,(H,31,34)(H,32,35)(H,36,37)(H4,27,28,29)/t17-,18-/m0/s1 |
| InChIKey | ZJRVNTQPMGMJOH-ROUUACIJSA-N |
| XLogP | 1.58 |
| TPSA | 195.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|