C17H17Cl2N7O — CID 164616769
1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]amino]urea (PubChem CID 164616769) has the molecular formula C17H17Cl2N7O and a molecular weight of 406.28 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]amino]urea |
|---|---|
| PubChem CID | 164616769 |
| Molecular Formula | C17H17Cl2N7O |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[5-(1,3-dimethylpyrazol-4-yl)-4-methyl-2-pyridinyl]amino]urea |
| SMILES | Cc1cc(NNC(=O)Nc2cc(Cl)nc(Cl)c2)ncc1-c1cn(C)nc1C |
| InChI | InChI=1S/C17H17Cl2N7O/c1-9-4-16(20-7-12(9)13-8-26(3)25-10(13)2)23-24-17(27)21-11-5-14(18)22-15(19)6-11/h4-8H,1-3H3,(H,20,23)(H2,21,22,24,27) |
| InChIKey | UHHXLQZEDJHJPR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|