C18H16N2O2S — CID 164616828
2-cyclopentyl-4-thieno[2,3-d]pyrimidin-4-ylbenzoic acid (PubChem CID 164616828) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-cyclopentyl-4-thieno[2,3-d]pyrimidin-4-ylbenzoic acid.
| Compound Name | 2-cyclopentyl-4-thieno[2,3-d]pyrimidin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 164616828 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-cyclopentyl-4-thieno[2,3-d]pyrimidin-4-ylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ncnc3sccc23)cc1C1CCCC1 |
| InChI | InChI=1S/C18H16N2O2S/c21-18(22)13-6-5-12(9-15(13)11-3-1-2-4-11)16-14-7-8-23-17(14)20-10-19-16/h5-11H,1-4H2,(H,21,22) |
| InChIKey | BPARVJYVENJOLF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |