C21H20N3O2+ — CID 164617013
ethyl 8-benzyl-6-methyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-4-carboxylate (PubChem CID 164617013) has the molecular formula C21H20N3O2+ and a molecular weight of 346.41 g/mol. Its IUPAC name is ethyl 8-benzyl-6-methyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-4-carboxylate.
| Compound Name | ethyl 8-benzyl-6-methyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 164617013 |
| Molecular Formula | C21H20N3O2+ |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | ethyl 8-benzyl-6-methyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(c(C)n1)[n+](Cc1ccccc1)c1ccccn21 |
| InChI | InChI=1S/C21H20N3O2/c1-3-26-21(25)17-13-18-20(15(2)22-17)24(14-16-9-5-4-6-10-16)19-11-7-8-12-23(18)19/h4-13H,3,14H2,1-2H3/q+1 |
| InChIKey | HXUBURLTRGVYJB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|