C15H17N2O5P — CID 164617083
4-(5-benzyl-2,4-dioxopyrimidin-1-yl)but-2-enylphosphonic acid (PubChem CID 164617083) has the molecular formula C15H17N2O5P and a molecular weight of 336.28 g/mol. Its IUPAC name is 4-(5-benzyl-2,4-dioxopyrimidin-1-yl)but-2-enylphosphonic acid.
| Compound Name | 4-(5-benzyl-2,4-dioxopyrimidin-1-yl)but-2-enylphosphonic acid |
|---|---|
| PubChem CID | 164617083 |
| Molecular Formula | C15H17N2O5P |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-(5-benzyl-2,4-dioxopyrimidin-1-yl)but-2-enylphosphonic acid |
| SMILES | O=c1[nH]c(=O)n(CC=CCP(=O)(O)O)cc1Cc1ccccc1 |
| InChI | InChI=1S/C15H17N2O5P/c18-14-13(10-12-6-2-1-3-7-12)11-17(15(19)16-14)8-4-5-9-23(20,21)22/h1-7,11H,8-10H2,(H,16,18,19)(H2,20,21,22) |
| InChIKey | DWALGNXIBIOVAI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|