About 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide
4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide (PubChem CID 164617090) has the molecular formula C22H24N4O5
and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide |
| PubChem CID | 164617090 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide |
| SMILES | COc1cc(OC)c2c(N3CCOC[C@@H]3C)nc(-c3ccc(C(=O)NO)cc3)nc2c1 |
| InChI | InChI=1S/C22H24N4O5/c1-13-12-31-9-8-26(13)21-19-17(10-16(29-2)11-18(19)30-3)23-20(24-21)14-4-6-15(7-5-14)22(27)25-28/h4-7,10-11,13,28H,8-9,12H2,1-3H3,(H,25,27)/t13-/m0/s1 |
| InChIKey | JGXDOAQGYGJXIZ-ZDUSSCGKSA-N |
| XLogP | 2.66 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide?
The IUPAC name of 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide (CID 164617090) is 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide?
The canonical SMILES for 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide is COc1cc(OC)c2c(N3CCOC[C@@H]3C)nc(-c3ccc(C(=O)NO)cc3)nc2c1.
What is the InChIKey of 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide?
The InChIKey is JGXDOAQGYGJXIZ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C22H24N4O5/c1-13-12-31-9-8-26(13)21-19-17(10-16(29-2)11-18(19)30-3)23-20(24-21)14-4-6-15(7-5-14)22(27)25-28/h4-7,10-11,13,28H,8-9,12H2,1-3H3,(H,25,27)/t13-/m0/s1.
What are the key properties of 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide?
4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide has a molecular weight of 424.46 g/mol, XLogP of 2.66, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5,7-dimethoxy-4-[(3S)-3-methylmorpholin-4-yl]quinazolin-2-yl]-N-hydroxybenzamide is sourced from PubChem (CID 164617090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).