C23H32O11 — CID 164617243
[(1S,2R,4S,5R,6S,7S,9R,12R)-5,7,12-triacetyloxy-4-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate (PubChem CID 164617243) has the molecular formula C23H32O11 and a molecular weight of 484.50 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6S,7S,9R,12R)-5,7,12-triacetyloxy-4-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate.
| Compound Name | [(1S,2R,4S,5R,6S,7S,9R,12R)-5,7,12-triacetyloxy-4-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 164617243 |
| Molecular Formula | C23H32O11 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [(1S,2R,4S,5R,6S,7S,9R,12R)-5,7,12-triacetyloxy-4-hydroxy-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12[C@H](OC(C)=O)C(=O)[C@@H]3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@H](C)C[C@H](O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C23H32O11/c1-10-8-15(28)18(31-12(3)25)22(9-30-11(2)24)20(33-14(5)27)17(29)16-19(32-13(4)26)23(10,22)34-21(16,6)7/h10,15-16,18-20,28H,8-9H2,1-7H3/t10-,15+,16-,18+,19-,20-,22+,23-/m1/s1 |
| InChIKey | ZFNDZHVNJCYSEW-KYJRXYQZSA-N |
| XLogP | 0.48 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|