C21H24N6O3 — CID 164617245
N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide (PubChem CID 164617245) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 164617245 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)NO)C1CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C21H24N6O3/c28-20(25-17(21(29)26-30)12-14-4-2-1-3-5-14)15-7-10-27(11-8-15)19-16-6-9-22-18(16)23-13-24-19/h1-6,9,13,15,17,30H,7-8,10-12H2,(H,25,28)(H,26,29)(H,22,23,24)/t17-/m1/s1 |
| InChIKey | RUGGJLUQAMBJLC-QGZVFWFLSA-N |
| XLogP | 1.41 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|