C27H33ClN6O5S — CID 164617258
4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (PubChem CID 164617258) has the molecular formula C27H33ClN6O5S and a molecular weight of 589.12 g/mol. Its IUPAC name is 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide.
| Compound Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 164617258 |
| Molecular Formula | C27H33ClN6O5S |
| Molecular Weight | 589.12 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | 4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)NCCCCCCC(=O)NO)cc2)ncc1Cl |
| InChI | InChI=1S/C27H33ClN6O5S/c1-18(2)40(38,39)23-10-7-6-9-22(23)32-25-21(28)17-30-27(33-25)31-20-14-12-19(13-15-20)26(36)29-16-8-4-3-5-11-24(35)34-37/h6-7,9-10,12-15,17-18,37H,3-5,8,11,16H2,1-2H3,(H,29,36)(H,34,35)(H2,30,31,32,33) |
| InChIKey | RBYNLDMNBXNZMS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.12 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|