About methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate
methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate (PubChem CID 164617336) has the molecular formula C22H19F2N5O3
and a molecular weight of 439.42 g/mol. Its IUPAC name is methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate.
Molecular Properties
| Compound Name | methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate |
| PubChem CID | 164617336 |
| Molecular Formula | C22H19F2N5O3 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(-n2cnc3cnc(Nc4cc(F)c(O)c(F)c4)nc32)cc1 |
| InChI | InChI=1S/C22H19F2N5O3/c1-32-19(30)4-2-3-13-5-7-15(8-6-13)29-12-26-18-11-25-22(28-21(18)29)27-14-9-16(23)20(31)17(24)10-14/h5-12,31H,2-4H2,1H3,(H,25,27,28) |
| InChIKey | VRKGHNSJGKKFFV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate?
The IUPAC name of methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate (CID 164617336) is methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate.
What is the SMILES notation for methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate?
The canonical SMILES for methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate is COC(=O)CCCc1ccc(-n2cnc3cnc(Nc4cc(F)c(O)c(F)c4)nc32)cc1.
What is the InChIKey of methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate?
The InChIKey is VRKGHNSJGKKFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2N5O3/c1-32-19(30)4-2-3-13-5-7-15(8-6-13)29-12-26-18-11-25-22(28-21(18)29)27-14-9-16(23)20(31)17(24)10-14/h5-12,31H,2-4H2,1H3,(H,25,27,28).
What are the key properties of methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate?
methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate has a molecular weight of 439.42 g/mol, XLogP of 4.04, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-[2-(3,5-difluoro-4-hydroxyanilino)purin-9-yl]phenyl]butanoate is sourced from PubChem (CID 164617336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).