About 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one
3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 164617385) has the molecular formula C22H17N3OS
and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one |
| PubChem CID | 164617385 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(C=CNc1cc(-c2ccccc2)nn1-c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C22H17N3OS/c26-20(21-12-7-15-27-21)13-14-23-22-16-19(17-8-3-1-4-9-17)24-25(22)18-10-5-2-6-11-18/h1-16,23H |
| InChIKey | POVFJFLJOKJHND-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one?
The IUPAC name of 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one (CID 164617385) is 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one.
What is the SMILES notation for 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one?
The canonical SMILES for 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one is O=C(C=CNc1cc(-c2ccccc2)nn1-c1ccccc1)c1cccs1.
What is the InChIKey of 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one?
The InChIKey is POVFJFLJOKJHND-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3OS/c26-20(21-12-7-15-27-21)13-14-23-22-16-19(17-8-3-1-4-9-17)24-25(22)18-10-5-2-6-11-18/h1-16,23H.
What are the key properties of 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one?
3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one has a molecular weight of 371.47 g/mol, XLogP of 5.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,3-diphenylpyrazol-5-yl)amino]-1-thiophen-2-ylprop-2-en-1-one is sourced from PubChem (CID 164617385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).