C17H15ClN4O2 — CID 164617393
4-chloro-N,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 164617393) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is 4-chloro-N,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 164617393 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-chloro-N,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Nc2nc(Cl)nc(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C17H15ClN4O2/c1-23-13-7-3-11(4-8-13)15-20-16(18)22-17(21-15)19-12-5-9-14(24-2)10-6-12/h3-10H,1-2H3,(H,19,20,21,22) |
| InChIKey | SOZPSYWSBURAOI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |