About ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate
ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate (PubChem CID 164617508) has the molecular formula C24H25NO7
and a molecular weight of 439.46 g/mol. Its IUPAC name is ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate |
| PubChem CID | 164617508 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)CC1 |
| InChI | InChI=1S/C24H25NO7/c1-2-31-24(30)15-7-9-25(10-8-15)13-17-18(27)11-19(28)22-20(29)12-21(32-23(17)22)14-3-5-16(26)6-4-14/h3-6,11-12,15,26-28H,2,7-10,13H2,1H3 |
| InChIKey | KHTYUQMITQHDQX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate (CID 164617508) is ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(Cc2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)CC1.
What is the InChIKey of ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate?
The InChIKey is KHTYUQMITQHDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO7/c1-2-31-24(30)15-7-9-25(10-8-15)13-17-18(27)11-19(28)22-20(29)12-21(32-23(17)22)14-3-5-16(26)6-4-14/h3-6,11-12,15,26-28H,2,7-10,13H2,1H3.
What are the key properties of ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate?
ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate has a molecular weight of 439.46 g/mol, XLogP of 3.35, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-8-yl]methyl]piperidine-4-carboxylate is sourced from PubChem (CID 164617508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).