C35H35ClF2N5O3+ — CID 164617734
1-[4-chloro-3-(7-pyridin-1-ium-1-ylheptoxy)phenyl]-N-(3,5-difluorophenyl)-7-(dimethylamino)-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 164617734) has the molecular formula C35H35ClF2N5O3+ and a molecular weight of 647.15 g/mol. Its IUPAC name is 1-[4-chloro-3-(7-pyridin-1-ium-1-ylheptoxy)phenyl]-N-(3,5-difluorophenyl)-7-(dimethylamino)-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[4-chloro-3-(7-pyridin-1-ium-1-ylheptoxy)phenyl]-N-(3,5-difluorophenyl)-7-(dimethylamino)-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 164617734 |
| Molecular Formula | C35H35ClF2N5O3+ |
| Molecular Weight | 647.15 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 1-[4-chloro-3-(7-pyridin-1-ium-1-ylheptoxy)phenyl]-N-(3,5-difluorophenyl)-7-(dimethylamino)-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CN(C)c1ccc2c(=O)c(C(=O)Nc3cc(F)cc(F)c3)cn(-c3ccc(Cl)c(OCCCCCCC[n+]4ccccc4)c3)c2n1 |
| InChI | InChI=1S/C35H34ClF2N5O3/c1-41(2)32-14-12-28-33(44)29(35(45)39-26-20-24(37)19-25(38)21-26)23-43(34(28)40-32)27-11-13-30(36)31(22-27)46-18-10-5-3-4-7-15-42-16-8-6-9-17-42/h6,8-9,11-14,16-17,19-23H,3-5,7,10,15,18H2,1-2H3/p+1 |
| InChIKey | XQSPIAUVTJSUMM-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.15 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|