About 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide
5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide (PubChem CID 164617763) has the molecular formula C22H20N4OS
and a molecular weight of 388.50 g/mol. Its IUPAC name is 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide |
| PubChem CID | 164617763 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C)n(Cc2ccc(C(=O)Nc3ccc(-c4cccnc4)cc3)s2)n1 |
| InChI | InChI=1S/C22H20N4OS/c1-15-12-16(2)26(25-15)14-20-9-10-21(28-20)22(27)24-19-7-5-17(6-8-19)18-4-3-11-23-13-18/h3-13H,14H2,1-2H3,(H,24,27) |
| InChIKey | SATPWKMQYADNSO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide?
The IUPAC name of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide (CID 164617763) is 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide.
What is the SMILES notation for 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide?
The canonical SMILES for 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide is Cc1cc(C)n(Cc2ccc(C(=O)Nc3ccc(-c4cccnc4)cc3)s2)n1.
What is the InChIKey of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide?
The InChIKey is SATPWKMQYADNSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4OS/c1-15-12-16(2)26(25-15)14-20-9-10-21(28-20)22(27)24-19-7-5-17(6-8-19)18-4-3-11-23-13-18/h3-13H,14H2,1-2H3,(H,24,27).
What are the key properties of 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide?
5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide has a molecular weight of 388.50 g/mol, XLogP of 4.92, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(4-pyridin-3-ylphenyl)thiophene-2-carboxamide is sourced from PubChem (CID 164617763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).