C22H17Cl2N5O2 — CID 164617878
4-[[5-(3,4-dichlorophenyl)-2-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide (PubChem CID 164617878) has the molecular formula C22H17Cl2N5O2 and a molecular weight of 454.32 g/mol. Its IUPAC name is 4-[[5-(3,4-dichlorophenyl)-2-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide.
| Compound Name | 4-[[5-(3,4-dichlorophenyl)-2-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164617878 |
| Molecular Formula | C22H17Cl2N5O2 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 4-[[5-(3,4-dichlorophenyl)-2-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(NCc2nc(-c3ccc(Cl)c(Cl)c3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17Cl2N5O2/c23-18-11-8-15(12-19(18)24)21-26-20(29(27-21)17-4-2-1-3-5-17)13-25-16-9-6-14(7-10-16)22(30)28-31/h1-12,25,31H,13H2,(H,28,30) |
| InChIKey | QKJYJGVJYWMNTK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|