C25H25NO6 — CID 164617902
[(1S,2S,4R,7R,9S,12S)-4-methyl-13-methylidene-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-9-yl]methyl quinoline-6-carboxylate (PubChem CID 164617902) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is [(1S,2S,4R,7R,9S,12S)-4-methyl-13-methylidene-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-9-yl]methyl quinoline-6-carboxylate.
| Compound Name | [(1S,2S,4R,7R,9S,12S)-4-methyl-13-methylidene-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-9-yl]methyl quinoline-6-carboxylate |
|---|---|
| PubChem CID | 164617902 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [(1S,2S,4R,7R,9S,12S)-4-methyl-13-methylidene-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-9-yl]methyl quinoline-6-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC[C@@]1(COC(=O)c3ccc4ncccc4c3)O[C@@H]1CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C25H25NO6/c1-14-17-7-10-25(13-29-23(28)16-5-6-18-15(12-16)4-3-11-26-18)19(31-25)8-9-24(2)21(32-24)20(17)30-22(14)27/h3-6,11-12,17,19-21H,1,7-10,13H2,2H3/t17-,19+,20-,21-,24+,25-/m0/s1 |
| InChIKey | DFKOUIDWLADJNB-JYMWEZEISA-N |
| XLogP | 3.36 |
| TPSA | 90.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|