C24H23N5O3S — CID 164617913
N-[2-[[2-[4-(1,3-benzoxazol-5-yl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-5-yl]methylamino]ethyl]acetamide (PubChem CID 164617913) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[2-[[2-[4-(1,3-benzoxazol-5-yl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-5-yl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[2-[4-(1,3-benzoxazol-5-yl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-5-yl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 164617913 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[2-[[2-[4-(1,3-benzoxazol-5-yl)-2,3-dihydroindole-1-carbonyl]-1,3-thiazol-5-yl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1cnc(C(=O)N2CCc3c(-c4ccc5ocnc5c4)cccc32)s1 |
| InChI | InChI=1S/C24H23N5O3S/c1-15(30)26-9-8-25-12-17-13-27-23(33-17)24(31)29-10-7-19-18(3-2-4-21(19)29)16-5-6-22-20(11-16)28-14-32-22/h2-6,11,13-14,25H,7-10,12H2,1H3,(H,26,30) |
| InChIKey | FFNUWSKEDYZMMO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|