C12H18O4 — CID 164618003
(1S,2R,5R,6R)-3-(hydroxymethyl)-4-[(E)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol (PubChem CID 164618003) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1S,2R,5R,6R)-3-(hydroxymethyl)-4-[(E)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol.
| Compound Name | (1S,2R,5R,6R)-3-(hydroxymethyl)-4-[(E)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
|---|---|
| PubChem CID | 164618003 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1S,2R,5R,6R)-3-(hydroxymethyl)-4-[(E)-pent-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-diol |
| SMILES | CCC/C=C/C1=C(CO)[C@@H](O)[C@@H]2O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C12H18O4/c1-2-3-4-5-7-8(6-13)10(15)12-11(16-12)9(7)14/h4-5,9-15H,2-3,6H2,1H3/b5-4+/t9-,10-,11-,12+/m1/s1 |
| InChIKey | JKYQNCJKJUVWRL-DCBQNDSVSA-N |
| XLogP | 0.13 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|