About 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid
2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid (PubChem CID 164618015) has the molecular formula C26H24N2O2
and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
| PubChem CID | 164618015 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
| SMILES | Cn1cc(-c2ccc(C(=O)O)c(C3CCCC3)c2)c2cc(-c3ccccc3)cnc21 |
| InChI | InChI=1S/C26H24N2O2/c1-28-16-24(23-14-20(15-27-25(23)28)17-7-3-2-4-8-17)19-11-12-21(26(29)30)22(13-19)18-9-5-6-10-18/h2-4,7-8,11-16,18H,5-6,9-10H2,1H3,(H,29,30) |
| InChIKey | MEKUVWMJNBFRNF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
The IUPAC name of 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid (CID 164618015) is 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid.
What is the SMILES notation for 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
The canonical SMILES for 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid is Cn1cc(-c2ccc(C(=O)O)c(C3CCCC3)c2)c2cc(-c3ccccc3)cnc21.
What is the InChIKey of 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
The InChIKey is MEKUVWMJNBFRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O2/c1-28-16-24(23-14-20(15-27-25(23)28)17-7-3-2-4-8-17)19-11-12-21(26(29)30)22(13-19)18-9-5-6-10-18/h2-4,7-8,11-16,18H,5-6,9-10H2,1H3,(H,29,30).
What are the key properties of 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid?
2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid has a molecular weight of 396.49 g/mol, XLogP of 6.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-4-(1-methyl-5-phenylpyrrolo[2,3-b]pyridin-3-yl)benzoic acid is sourced from PubChem (CID 164618015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).