C31H32N2O2 — CID 164618064
N-[(2S,3S)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-2,2-diphenylacetamide (PubChem CID 164618064) has the molecular formula C31H32N2O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[(2S,3S)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[(2S,3S)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 164618064 |
| Molecular Formula | C31H32N2O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | N-[(2S,3S)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-2,2-diphenylacetamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)CNCc1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32N2O2/c34-29(23-32-22-25-15-7-2-8-16-25)28(21-24-13-5-1-6-14-24)33-31(35)30(26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20,28-30,32,34H,21-23H2,(H,33,35)/t28-,29-/m0/s1 |
| InChIKey | PRXGHCUDNWBFEE-VMPREFPWSA-N |
| XLogP | 4.70 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |